C24H33FN2O3 — CID 142923852
3-amino-N-hydroxy-2-methylpropanamide;ethane;1-[4-[2-(2-fluorophenyl)ethynyl]phenyl]ethanone (PubChem CID 142923852) has the molecular formula C24H33FN2O3 and a molecular weight of 416.54 g/mol. Its IUPAC name is 3-amino-N-hydroxy-2-methylpropanamide;ethane;1-[4-[2-(2-fluorophenyl)ethynyl]phenyl]ethanone.
| Compound Name | 3-amino-N-hydroxy-2-methylpropanamide;ethane;1-[4-[2-(2-fluorophenyl)ethynyl]phenyl]ethanone |
|---|---|
| PubChem CID | 142923852 |
| Molecular Formula | C24H33FN2O3 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-amino-N-hydroxy-2-methylpropanamide;ethane;1-[4-[2-(2-fluorophenyl)ethynyl]phenyl]ethanone |
| SMILES | CC.CC.CC(=O)c1ccc(C#Cc2ccccc2F)cc1.CC(CN)C(=O)NO |
| InChI | InChI=1S/C16H11FO.C4H10N2O2.2C2H6/c1-12(18)14-9-6-13(7-10-14)8-11-15-4-2-3-5-16(15)17;1-3(2-5)4(7)6-8;2*1-2/h2-7,9-10H,1H3;3,8H,2,5H2,1H3,(H,6,7);2*1-2H3 |
| InChIKey | VOCDXRKCVFFNJD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|