C16H10F3IrN2O- — CID 59515037
7,8-dimethyl-3-(trifluoromethoxy)-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium (PubChem CID 59515037) has the molecular formula C16H10F3IrN2O- and a molecular weight of 495.48 g/mol. Its IUPAC name is 7,8-dimethyl-3-(trifluoromethoxy)-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium.
| Compound Name | 7,8-dimethyl-3-(trifluoromethoxy)-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium |
|---|---|
| PubChem CID | 59515037 |
| Molecular Formula | C16H10F3IrN2O- |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 7,8-dimethyl-3-(trifluoromethoxy)-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium |
| SMILES | Cc1nc2c(n1C)-c1cccc3c(OC(F)(F)F)c[c-]c-2c13.[Ir] |
| InChI | InChI=1S/C16H10F3N2O.Ir/c1-8-20-14-10-6-7-12(22-16(17,18)19)9-4-3-5-11(13(9)10)15(14)21(8)2;/h3-5,7H,1-2H3;/q-1; |
| InChIKey | FOMBFWPVWFSAGY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|