C15H10FIrN2- — CID 59515042
2-fluoro-7,8-dimethyl-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium (PubChem CID 59515042) has the molecular formula C15H10FIrN2- and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-fluoro-7,8-dimethyl-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium.
| Compound Name | 2-fluoro-7,8-dimethyl-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium |
|---|---|
| PubChem CID | 59515042 |
| Molecular Formula | C15H10FIrN2- |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-fluoro-7,8-dimethyl-1H-acenaphthyleno[1,2-d]imidazol-1-ide;iridium |
| SMILES | Cc1nc2c(n1C)-c1cccc3cc(F)[c-]c-2c13.[Ir] |
| InChI | InChI=1S/C15H10FN2.Ir/c1-8-17-14-12-7-10(16)6-9-4-3-5-11(13(9)12)15(14)18(8)2;/h3-6H,1-2H3;/q-1; |
| InChIKey | BQEPRCNFBWMGIP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|