C10H11F3N2 — CID 142266427
3-ethyl-2-(trifluoromethyl)-4,5-dihydrobenzimidazole (PubChem CID 142266427) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 3-ethyl-2-(trifluoromethyl)-4,5-dihydrobenzimidazole.
| Compound Name | 3-ethyl-2-(trifluoromethyl)-4,5-dihydrobenzimidazole |
|---|---|
| PubChem CID | 142266427 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-ethyl-2-(trifluoromethyl)-4,5-dihydrobenzimidazole |
| SMILES | CCn1c(C(F)(F)F)nc2c1CCC=C2 |
| InChI | InChI=1S/C10H11F3N2/c1-2-15-8-6-4-3-5-7(8)14-9(15)10(11,12)13/h3,5H,2,4,6H2,1H3 |
| InChIKey | ZPDQLMKKJIRTGL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |