C10H14BNO — CID 59515328
[(1-methyl-2,3-dihydro-1-benzoborol-7-yl)amino]methanol (PubChem CID 59515328) has the molecular formula C10H14BNO and a molecular weight of 175.04 g/mol. Its IUPAC name is [(1-methyl-2,3-dihydro-1-benzoborol-7-yl)amino]methanol.
| Compound Name | [(1-methyl-2,3-dihydro-1-benzoborol-7-yl)amino]methanol |
|---|---|
| PubChem CID | 59515328 |
| Molecular Formula | C10H14BNO |
| Molecular Weight | 175.04 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | [(1-methyl-2,3-dihydro-1-benzoborol-7-yl)amino]methanol |
| SMILES | CB1CCc2cccc(NCO)c21 |
| InChI | InChI=1S/C10H14BNO/c1-11-6-5-8-3-2-4-9(10(8)11)12-7-13/h2-4,12-13H,5-7H2,1H3 |
| InChIKey | FDFUZXNUTHVEJO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.04 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|