C16H15N3O2 — CID 59517613
prop-2-ynyl 4-(dimethylamino)-2-phenylpyrimidine-5-carboxylate (PubChem CID 59517613) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is prop-2-ynyl 4-(dimethylamino)-2-phenylpyrimidine-5-carboxylate.
| Compound Name | prop-2-ynyl 4-(dimethylamino)-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 59517613 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | prop-2-ynyl 4-(dimethylamino)-2-phenylpyrimidine-5-carboxylate |
| SMILES | C#CCOC(=O)c1cnc(-c2ccccc2)nc1N(C)C |
| InChI | InChI=1S/C16H15N3O2/c1-4-10-21-16(20)13-11-17-14(18-15(13)19(2)3)12-8-6-5-7-9-12/h1,5-9,11H,10H2,2-3H3 |
| InChIKey | ADPCRPFPHJKJBJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|