C21H37Na2O9PS — CID 59520923
disodium;[(2S)-3-(8-acetylsulfanyloctanoyloxy)-2-octanoyloxypropyl] phosphate (PubChem CID 59520923) has the molecular formula C21H37Na2O9PS and a molecular weight of 542.54 g/mol. Its IUPAC name is disodium;[(2S)-3-(8-acetylsulfanyloctanoyloxy)-2-octanoyloxypropyl] phosphate.
| Compound Name | disodium;[(2S)-3-(8-acetylsulfanyloctanoyloxy)-2-octanoyloxypropyl] phosphate |
|---|---|
| PubChem CID | 59520923 |
| Molecular Formula | C21H37Na2O9PS |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | disodium;[(2S)-3-(8-acetylsulfanyloctanoyloxy)-2-octanoyloxypropyl] phosphate |
| SMILES | CCCCCCCC(=O)O[C@@H](COC(=O)CCCCCCCSC(C)=O)COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H39O9PS.2Na/c1-3-4-5-7-11-14-21(24)30-19(17-29-31(25,26)27)16-28-20(23)13-10-8-6-9-12-15-32-18(2)22;;/h19H,3-17H2,1-2H3,(H2,25,26,27);;/q;2*+1/p-2/t19-;;/m0../s1 |
| InChIKey | MFXYUBRWEMFBPE-TXEPZDRESA-L |
| XLogP | -2.72 |
| TPSA | 142.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|