C27H32BF2N4O4S+ — CID 59523489
3-[12-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-2,2-difluoro-10-methyl-4-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl]propyl-trimethylazanium (PubChem CID 59523489) has the molecular formula C27H32BF2N4O4S+ and a molecular weight of 557.45 g/mol. Its IUPAC name is 3-[12-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-2,2-difluoro-10-methyl-4-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl]propyl-trimethylazanium.
| Compound Name | 3-[12-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-2,2-difluoro-10-methyl-4-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 59523489 |
| Molecular Formula | C27H32BF2N4O4S+ |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 3-[12-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-2,2-difluoro-10-methyl-4-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-6-yl]propyl-trimethylazanium |
| SMILES | Cc1cc(CCC(=O)ON2C(=O)CCC2=O)n2c1C=C1C(CCC[N+](C)(C)C)=CC(c3cccs3)=[N+]1[B-]2(F)F |
| InChI | InChI=1S/C27H32BF2N4O4S/c1-18-15-20(9-12-27(37)38-33-25(35)10-11-26(33)36)31-21(18)17-22-19(7-5-13-34(2,3)4)16-23(24-8-6-14-39-24)32(22)28(31,29)30/h6,8,14-17H,5,7,9-13H2,1-4H3/q+1 |
| InChIKey | DZIHJBIOTLJNIP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|