C31H30N2O2S — CID 59527744
4-phenyl-N-[(1S)-1-phenylethyl]-1-(5-phenylthiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 59527744) has the molecular formula C31H30N2O2S and a molecular weight of 494.66 g/mol. Its IUPAC name is 4-phenyl-N-[(1S)-1-phenylethyl]-1-(5-phenylthiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | 4-phenyl-N-[(1S)-1-phenylethyl]-1-(5-phenylthiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 59527744 |
| Molecular Formula | C31H30N2O2S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-phenyl-N-[(1S)-1-phenylethyl]-1-(5-phenylthiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | C[C@H](NC(=O)C1(c2ccccc2)CCN(C(=O)c2ccc(-c3ccccc3)s2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O2S/c1-23(24-11-5-2-6-12-24)32-30(35)31(26-15-9-4-10-16-26)19-21-33(22-20-31)29(34)28-18-17-27(36-28)25-13-7-3-8-14-25/h2-18,23H,19-22H2,1H3,(H,32,35)/t23-/m0/s1 |
| InChIKey | ZMODIMFKURPOKQ-QHCPKHFHSA-N |
| XLogP | 6.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |