C32H37N3O2 — CID 59527796
4-phenyl-N-[(1S)-1-phenylethyl]-1-(4-piperidin-1-ylbenzoyl)piperidine-4-carboxamide (PubChem CID 59527796) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 4-phenyl-N-[(1S)-1-phenylethyl]-1-(4-piperidin-1-ylbenzoyl)piperidine-4-carboxamide.
| Compound Name | 4-phenyl-N-[(1S)-1-phenylethyl]-1-(4-piperidin-1-ylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 59527796 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 4-phenyl-N-[(1S)-1-phenylethyl]-1-(4-piperidin-1-ylbenzoyl)piperidine-4-carboxamide |
| SMILES | C[C@H](NC(=O)C1(c2ccccc2)CCN(C(=O)c2ccc(N3CCCCC3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H37N3O2/c1-25(26-11-5-2-6-12-26)33-31(37)32(28-13-7-3-8-14-28)19-23-35(24-20-32)30(36)27-15-17-29(18-16-27)34-21-9-4-10-22-34/h2-3,5-8,11-18,25H,4,9-10,19-24H2,1H3,(H,33,37)/t25-/m0/s1 |
| InChIKey | ZBSHNVUZWYUZPI-VWLOTQADSA-N |
| XLogP | 5.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |