7-chloro-5-fluoro-1H-indole-2-carboxylic acid

C9H5ClFNO2 — CID 59529914

IUPAC7-chloro-5-fluoro-1H-indole-2-carboxylic acid
SMILESO=C(O)c1cc2cc(F)cc(Cl)c2[nH]1
InChIInChI=1S/C9H5ClFNO2/c10-6-3-5(11)1-4-2-7(9(13)14)12-8(4)6/h1-3,12H,(H,13,14)
InChIKeyRPVKLDOSNVTXHF-UHFFFAOYSA-N
MW213.59 g/mol
LogP2.66
Rot. Bonds1

About 7-chloro-5-fluoro-1H-indole-2-carboxylic acid

7-chloro-5-fluoro-1H-indole-2-carboxylic acid (PubChem CID 59529914) has the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. Its IUPAC name is 7-chloro-5-fluoro-1H-indole-2-carboxylic acid.

Molecular Properties

Compound Name7-chloro-5-fluoro-1H-indole-2-carboxylic acid
PubChem CID59529914
Molecular FormulaC9H5ClFNO2
Molecular Weight213.59 g/mol
Exact Mass213.00
IUPAC Name7-chloro-5-fluoro-1H-indole-2-carboxylic acid
SMILESO=C(O)c1cc2cc(F)cc(Cl)c2[nH]1
InChIInChI=1S/C9H5ClFNO2/c10-6-3-5(11)1-4-2-7(9(13)14)12-8(4)6/h1-3,12H,(H,13,14)
InChIKeyRPVKLDOSNVTXHF-UHFFFAOYSA-N
XLogP2.66
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.59
LogP ≤ 52.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 7-chloro-5-fluoro-1H-indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-chloro-5-fluoro-1H-indole-2-carboxylic acid?
The IUPAC name of 7-chloro-5-fluoro-1H-indole-2-carboxylic acid (CID 59529914) is 7-chloro-5-fluoro-1H-indole-2-carboxylic acid.
What is the SMILES notation for 7-chloro-5-fluoro-1H-indole-2-carboxylic acid?
The canonical SMILES for 7-chloro-5-fluoro-1H-indole-2-carboxylic acid is O=C(O)c1cc2cc(F)cc(Cl)c2[nH]1.
What is the InChIKey of 7-chloro-5-fluoro-1H-indole-2-carboxylic acid?
The InChIKey is RPVKLDOSNVTXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClFNO2/c10-6-3-5(11)1-4-2-7(9(13)14)12-8(4)6/h1-3,12H,(H,13,14).
What are the key properties of 7-chloro-5-fluoro-1H-indole-2-carboxylic acid?
7-chloro-5-fluoro-1H-indole-2-carboxylic acid has a molecular weight of 213.59 g/mol, XLogP of 2.66, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-fluoro-1H-indole-2-carboxylic acid is sourced from PubChem (CID 59529914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).