C10H6ClFN2O3 — CID 136991076
3-(3-chloro-5-fluoro-2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 136991076) has the molecular formula C10H6ClFN2O3 and a molecular weight of 256.62 g/mol. Its IUPAC name is 3-(3-chloro-5-fluoro-2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(3-chloro-5-fluoro-2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136991076 |
| Molecular Formula | C10H6ClFN2O3 |
| Molecular Weight | 256.62 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 3-(3-chloro-5-fluoro-2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)cc(Cl)c2O)n[nH]1 |
| InChI | InChI=1S/C10H6ClFN2O3/c11-6-2-4(12)1-5(9(6)15)7-3-8(10(16)17)14-13-7/h1-3,15H,(H,13,14)(H,16,17) |
| InChIKey | JDCLZPPQQKYOGG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.62 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |