C32H34N4O — CID 59530546
4-tert-butyl-N-[6-(diethylamino)-2-naphthalen-1-yl-3H-benzimidazol-5-yl]benzamide (PubChem CID 59530546) has the molecular formula C32H34N4O and a molecular weight of 490.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[6-(diethylamino)-2-naphthalen-1-yl-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[6-(diethylamino)-2-naphthalen-1-yl-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 59530546 |
| Molecular Formula | C32H34N4O |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 4-tert-butyl-N-[6-(diethylamino)-2-naphthalen-1-yl-3H-benzimidazol-5-yl]benzamide |
| SMILES | CCN(CC)c1cc2nc(-c3cccc4ccccc34)[nH]c2cc1NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H34N4O/c1-6-36(7-2)29-20-27-26(33-30(34-27)25-14-10-12-21-11-8-9-13-24(21)25)19-28(29)35-31(37)22-15-17-23(18-16-22)32(3,4)5/h8-20H,6-7H2,1-5H3,(H,33,34)(H,35,37) |
| InChIKey | CBJITDWFQCMAPQ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |