C31H34F2N4O6 — CID 59531367
5-O-benzyl 1-O-tert-butyl 2-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]-1,2,5-triazepane-1,5-dicarboxylate (PubChem CID 59531367) has the molecular formula C31H34F2N4O6 and a molecular weight of 596.63 g/mol. Its IUPAC name is 5-O-benzyl 1-O-tert-butyl 2-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]-1,2,5-triazepane-1,5-dicarboxylate.
| Compound Name | 5-O-benzyl 1-O-tert-butyl 2-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]-1,2,5-triazepane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 59531367 |
| Molecular Formula | C31H34F2N4O6 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 5-O-benzyl 1-O-tert-butyl 2-[2,6-difluoro-4-(phenylmethoxycarbonylamino)phenyl]-1,2,5-triazepane-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CCN1c1c(F)cc(NC(=O)OCc2ccccc2)cc1F |
| InChI | InChI=1S/C31H34F2N4O6/c1-31(2,3)43-30(40)37-17-15-35(29(39)42-21-23-12-8-5-9-13-23)14-16-36(37)27-25(32)18-24(19-26(27)33)34-28(38)41-20-22-10-6-4-7-11-22/h4-13,18-19H,14-17,20-21H2,1-3H3,(H,34,38) |
| InChIKey | QBHOVAPLQZPZEC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|