C15H23NO5 — CID 59532827
1-O-[4-(2-methylprop-2-enoylamino)butyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 59532827) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-O-[4-(2-methylprop-2-enoylamino)butyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[4-(2-methylprop-2-enoylamino)butyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 59532827 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-O-[4-(2-methylprop-2-enoylamino)butyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | C=C(C)C(=O)NCCCCOC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C15H23NO5/c1-11(2)15(19)16-9-5-6-10-20-13(17)7-8-14(18)21-12(3)4/h7-8,12H,1,5-6,9-10H2,2-4H3,(H,16,19)/b8-7+ |
| InChIKey | YVEMBJKYXBAACU-BQYQJAHWSA-N |
| XLogP | 1.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|