C23H25N5O2S — CID 59534768
6-(1-methylindazol-6-yl)-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine (PubChem CID 59534768) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 6-(1-methylindazol-6-yl)-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine.
| Compound Name | 6-(1-methylindazol-6-yl)-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine |
|---|---|
| PubChem CID | 59534768 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 6-(1-methylindazol-6-yl)-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine |
| SMILES | Cn1ncc2ccc(-c3cc(NC4CCN(S(C)(=O)=O)CC4)c4cnccc4c3)cc21 |
| InChI | InChI=1S/C23H25N5O2S/c1-27-23-13-16(3-4-18(23)14-25-27)19-11-17-5-8-24-15-21(17)22(12-19)26-20-6-9-28(10-7-20)31(2,29)30/h3-5,8,11-15,20,26H,6-7,9-10H2,1-2H3 |
| InChIKey | KHWDOZVKRFKFNR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |