C24H26N4O2S — CID 59535034
4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-2-methylbenzonitrile (PubChem CID 59535034) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-2-methylbenzonitrile.
| Compound Name | 4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 59535034 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-2-methylbenzonitrile |
| SMILES | CCS(=O)(=O)N1CCC(Nc2cc(-c3ccc(C#N)c(C)c3)cc3ccncc23)CC1 |
| InChI | InChI=1S/C24H26N4O2S/c1-3-31(29,30)28-10-7-22(8-11-28)27-24-14-21(13-19-6-9-26-16-23(19)24)18-4-5-20(15-25)17(2)12-18/h4-6,9,12-14,16,22,27H,3,7-8,10-11H2,1-2H3 |
| InChIKey | ZXTXPJZUGOZCFZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |