C20H18BrN4O — CID 59535568
CID 59535568 (PubChem CID 59535568) has the molecular formula C20H18BrN4O and a molecular weight of 410.30 g/mol.
| Compound Name | CID 59535568 |
|---|---|
| PubChem CID | 59535568 |
| Molecular Formula | C20H18BrN4O |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | — |
| SMILES | CN(C)[CH]C1N=C2CN=C(c3ccccc3)c3cc(Br)ccc3N2C1=O |
| InChI | InChI=1S/C20H18BrN4O/c1-24(2)12-16-20(26)25-17-9-8-14(21)10-15(17)19(22-11-18(25)23-16)13-6-4-3-5-7-13/h3-10,12,16H,11H2,1-2H3 |
| InChIKey | QXRMMFLONNRSLJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |