C37H34F6NO3Pt- — CID 59538619
[3,5-bis(trifluoromethyl)phenyl]-[4-(6-phenyl-3-pyridinyl)phenyl]methanone;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum (PubChem CID 59538619) has the molecular formula C37H34F6NO3Pt- and a molecular weight of 849.75 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[4-(6-phenyl-3-pyridinyl)phenyl]methanone;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[4-(6-phenyl-3-pyridinyl)phenyl]methanone;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum |
|---|---|
| PubChem CID | 59538619 |
| Molecular Formula | C37H34F6NO3Pt- |
| Molecular Weight | 849.75 g/mol |
| Exact Mass | 849.21 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[4-(6-phenyl-3-pyridinyl)phenyl]methanone;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.O=C(c1ccc(-c2ccc(-c3[c-]cccc3)nc2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Pt] |
| InChI | InChI=1S/C26H14F6NO.C11H20O2.Pt/c27-25(28,29)21-12-20(13-22(14-21)26(30,31)32)24(34)18-8-6-16(7-9-18)19-10-11-23(33-15-19)17-4-2-1-3-5-17;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-4,6-15H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | CRYYSJYUGQVRFF-HXIBTQJOSA-N |
| XLogP | 10.57 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.75 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|