C22H22N4 — CID 59539167
2-methyl-6-[4-(2-methyl-3H-benzimidazol-5-yl)cyclohex-2-en-1-yl]-1H-benzimidazole (PubChem CID 59539167) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-methyl-6-[4-(2-methyl-3H-benzimidazol-5-yl)cyclohex-2-en-1-yl]-1H-benzimidazole.
| Compound Name | 2-methyl-6-[4-(2-methyl-3H-benzimidazol-5-yl)cyclohex-2-en-1-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 59539167 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-methyl-6-[4-(2-methyl-3H-benzimidazol-5-yl)cyclohex-2-en-1-yl]-1H-benzimidazole |
| SMILES | Cc1nc2ccc(C3C=CC(c4ccc5nc(C)[nH]c5c4)CC3)cc2[nH]1 |
| InChI | InChI=1S/C22H22N4/c1-13-23-19-9-7-17(11-21(19)25-13)15-3-5-16(6-4-15)18-8-10-20-22(12-18)26-14(2)24-20/h3,5,7-12,15-16H,4,6H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | PRGAHJJVYIJABW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|