C19H15F5N4O2 — CID 59539759
3-(3,4-difluorophenyl)-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide (PubChem CID 59539759) has the molecular formula C19H15F5N4O2 and a molecular weight of 426.35 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 59539759 |
| Molecular Formula | C19H15F5N4O2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
| SMILES | C[C@H](NC(=O)c1cc(-c2ccc(F)c(F)c2)cc(C(O)C(F)(F)F)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C19H15F5N4O2/c1-9(17-25-8-26-28-17)27-18(30)13-5-11(10-2-3-14(20)15(21)7-10)4-12(6-13)16(29)19(22,23)24/h2-9,16,29H,1H3,(H,27,30)(H,25,26,28)/t9-,16?/m0/s1 |
| InChIKey | DOOBIGNQCULHQW-XUOZKRPMSA-N |
| XLogP | 3.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |