C9H10N4OS — CID 103716265
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-3-carboxamide (PubChem CID 103716265) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-3-carboxamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103716265 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-3-carboxamide |
| SMILES | CC(NC(=O)c1ccsc1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H10N4OS/c1-6(8-10-5-11-13-8)12-9(14)7-2-3-15-4-7/h2-6H,1H3,(H,12,14)(H,10,11,13) |
| InChIKey | FEKLSEJVGMFJMG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |