C10H12N4OS — CID 103716446
2-thiophen-2-yl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide (PubChem CID 103716446) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide.
| Compound Name | 2-thiophen-2-yl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103716446 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-thiophen-2-yl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1cccs1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H12N4OS/c1-7(10-11-6-12-14-10)13-9(15)5-8-3-2-4-16-8/h2-4,6-7H,5H2,1H3,(H,13,15)(H,11,12,14) |
| InChIKey | NJRUFVIRQFXDQX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |