C18H17F3N2O7S — CID 59541611
[(7S)-2-acetyl-8-oxo-7-[(2-phenoxyacetyl)amino]-1-azabicyclo[4.2.0]oct-2-en-3-yl] trifluoromethanesulfonate (PubChem CID 59541611) has the molecular formula C18H17F3N2O7S and a molecular weight of 462.40 g/mol. Its IUPAC name is [(7S)-2-acetyl-8-oxo-7-[(2-phenoxyacetyl)amino]-1-azabicyclo[4.2.0]oct-2-en-3-yl] trifluoromethanesulfonate.
| Compound Name | [(7S)-2-acetyl-8-oxo-7-[(2-phenoxyacetyl)amino]-1-azabicyclo[4.2.0]oct-2-en-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59541611 |
| Molecular Formula | C18H17F3N2O7S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | [(7S)-2-acetyl-8-oxo-7-[(2-phenoxyacetyl)amino]-1-azabicyclo[4.2.0]oct-2-en-3-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CCC2[C@H](NC(=O)COc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C18H17F3N2O7S/c1-10(24)16-13(30-31(27,28)18(19,20)21)8-7-12-15(17(26)23(12)16)22-14(25)9-29-11-5-3-2-4-6-11/h2-6,12,15H,7-9H2,1H3,(H,22,25)/t12?,15-/m0/s1 |
| InChIKey | RZYYEDMKXQYEKS-CVRLYYSRSA-N |
| XLogP | 1.22 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|