C16H14F3N3O7S — CID 10551476
(6R,7S)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-1,4-diazabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 10551476) has the molecular formula C16H14F3N3O7S and a molecular weight of 449.36 g/mol. Its IUPAC name is (6R,7S)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-1,4-diazabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-1,4-diazabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10551476 |
| Molecular Formula | C16H14F3N3O7S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | (6R,7S)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-1,4-diazabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)O)=C(OS(=O)(=O)C(F)(F)F)NC[C@H]12 |
| InChI | InChI=1S/C16H14F3N3O7S/c17-16(18,19)30(27,28)29-13-12(15(25)26)22-9(7-20-13)11(14(22)24)21-10(23)6-8-4-2-1-3-5-8/h1-5,9,11,20H,6-7H2,(H,21,23)(H,25,26)/t9-,11+/m1/s1 |
| InChIKey | PTVCLVRGKCDEJP-KOLCDFICSA-N |
| XLogP | -0.35 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|