C16H12F3N2O7S2- — CID 22867251
(6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22867251) has the molecular formula C16H12F3N2O7S2- and a molecular weight of 465.41 g/mol. Its IUPAC name is (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22867251 |
| Molecular Formula | C16H12F3N2O7S2- |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(trifluoromethylsulfonyloxy)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(OS(=O)(=O)C(F)(F)F)CS[C@H]12 |
| InChI | InChI=1S/C16H13F3N2O7S2/c17-16(18,19)30(26,27)28-9-7-29-14-11(13(23)21(14)12(9)15(24)25)20-10(22)6-8-4-2-1-3-5-8/h1-5,11,14H,6-7H2,(H,20,22)(H,24,25)/p-1/t11-,14-/m1/s1 |
| InChIKey | OJJWUKKKWBZKJB-BXUZGUMPSA-M |
| XLogP | -0.54 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|