C24H24N2O8S2 — CID 88625271
[methoxy(phenyl)methyl] (6S,7R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88625271) has the molecular formula C24H24N2O8S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is [methoxy(phenyl)methyl] (6S,7R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [methoxy(phenyl)methyl] (6S,7R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88625271 |
| Molecular Formula | C24H24N2O8S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | [methoxy(phenyl)methyl] (6S,7R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC(OC(=O)C1=C(OS(C)(=O)=O)CS[C@H]2[C@H](NC(=O)Cc3ccccc3)C(=O)N12)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O8S2/c1-32-24(16-11-7-4-8-12-16)33-23(29)20-17(34-36(2,30)31)14-35-22-19(21(28)26(20)22)25-18(27)13-15-9-5-3-6-10-15/h3-12,19,22,24H,13-14H2,1-2H3,(H,25,27)/t19-,22+,24?/m1/s1 |
| InChIKey | PFRWMVAQOWSCQP-LOMQJKJHSA-N |
| XLogP | 1.71 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|