C18H14ClF5N4O — CID 59544185
N-[(1S)-1-(5-chloro-1-methylpyrazol-4-yl)ethyl]-2-(1,1,2,2,2-pentafluoroethyl)quinoline-6-carboxamide (PubChem CID 59544185) has the molecular formula C18H14ClF5N4O and a molecular weight of 432.78 g/mol. Its IUPAC name is N-[(1S)-1-(5-chloro-1-methylpyrazol-4-yl)ethyl]-2-(1,1,2,2,2-pentafluoroethyl)quinoline-6-carboxamide.
| Compound Name | N-[(1S)-1-(5-chloro-1-methylpyrazol-4-yl)ethyl]-2-(1,1,2,2,2-pentafluoroethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 59544185 |
| Molecular Formula | C18H14ClF5N4O |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[(1S)-1-(5-chloro-1-methylpyrazol-4-yl)ethyl]-2-(1,1,2,2,2-pentafluoroethyl)quinoline-6-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2nc(C(F)(F)C(F)(F)F)ccc2c1)c1cnn(C)c1Cl |
| InChI | InChI=1S/C18H14ClF5N4O/c1-9(12-8-25-28(2)15(12)19)26-16(29)11-3-5-13-10(7-11)4-6-14(27-13)17(20,21)18(22,23)24/h3-9H,1-2H3,(H,26,29)/t9-/m0/s1 |
| InChIKey | KPWNXPLNHLFPQF-VIFPVBQESA-N |
| XLogP | 4.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|