C25H25NO2P- — CID 59546423
(2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-4-methylpentanoate (PubChem CID 59546423) has the molecular formula C25H25NO2P- and a molecular weight of 402.45 g/mol. Its IUPAC name is (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-4-methylpentanoate.
| Compound Name | (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 59546423 |
| Molecular Formula | C25H25NO2P- |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](/N=C\c1ccccc1P(c1ccccc1)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C25H26NO2P/c1-19(2)17-23(25(27)28)26-18-20-11-9-10-16-24(20)29(21-12-5-3-6-13-21)22-14-7-4-8-15-22/h3-16,18-19,23H,17H2,1-2H3,(H,27,28)/p-1/b26-18-/t23-/m0/s1 |
| InChIKey | QKFXHVSRAWFRTQ-XCOOOMCFSA-M |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|