C26H34FN7O3 — CID 59548429
tert-butyl 4-[[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 59548429) has the molecular formula C26H34FN7O3 and a molecular weight of 511.60 g/mol. Its IUPAC name is tert-butyl 4-[[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59548429 |
| Molecular Formula | C26H34FN7O3 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | tert-butyl 4-[[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1nc(-c2cc(CN3CCN(C(=O)OC(C)(C)C)CC3)cnc2F)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C26H34FN7O3/c1-17-30-21(22-24(31-17)34(16-29-22)20-7-5-6-12-36-20)19-13-18(14-28-23(19)27)15-32-8-10-33(11-9-32)25(35)37-26(2,3)4/h13-14,16,20H,5-12,15H2,1-4H3 |
| InChIKey | USMNKNIEDRFSCJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|