C20H16ClFN8O2S — CID 59548448
N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 59548448) has the molecular formula C20H16ClFN8O2S and a molecular weight of 486.92 g/mol. Its IUPAC name is N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59548448 |
| Molecular Formula | C20H16ClFN8O2S |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1nc(N)nc(-c2cccnc2Nc2cnc(Cl)c(NS(=O)(=O)c3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C20H16ClFN8O2S/c1-11-26-19(29-20(23)27-11)15-3-2-8-24-18(15)28-13-9-16(17(21)25-10-13)30-33(31,32)14-6-4-12(22)5-7-14/h2-10,30H,1H3,(H,24,28)(H2,23,26,27,29) |
| InChIKey | MUNMOKXVNKEMSH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|