C29H26N6O2 — CID 59548784
2-[4-(2-pyrrolo[2,3-b]pyridin-1-ylacetyl)piperazin-1-yl]-N-quinolin-3-ylbenzamide (PubChem CID 59548784) has the molecular formula C29H26N6O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 2-[4-(2-pyrrolo[2,3-b]pyridin-1-ylacetyl)piperazin-1-yl]-N-quinolin-3-ylbenzamide.
| Compound Name | 2-[4-(2-pyrrolo[2,3-b]pyridin-1-ylacetyl)piperazin-1-yl]-N-quinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 59548784 |
| Molecular Formula | C29H26N6O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-[4-(2-pyrrolo[2,3-b]pyridin-1-ylacetyl)piperazin-1-yl]-N-quinolin-3-ylbenzamide |
| SMILES | O=C(Nc1cnc2ccccc2c1)c1ccccc1N1CCN(C(=O)Cn2ccc3cccnc32)CC1 |
| InChI | InChI=1S/C29H26N6O2/c36-27(20-35-13-11-21-7-5-12-30-28(21)35)34-16-14-33(15-17-34)26-10-4-2-8-24(26)29(37)32-23-18-22-6-1-3-9-25(22)31-19-23/h1-13,18-19H,14-17,20H2,(H,32,37) |
| InChIKey | NOWOIYARFXVTAF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |