C26H23N5O4 — CID 59548845
2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-N-pyridin-4-ylbenzamide (PubChem CID 59548845) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-N-pyridin-4-ylbenzamide.
| Compound Name | 2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 59548845 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperazin-1-yl]-N-pyridin-4-ylbenzamide |
| SMILES | O=C(Nc1ccncc1)c1ccccc1N1CCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C26H23N5O4/c32-23(17-31-25(34)19-5-1-2-6-20(19)26(31)35)30-15-13-29(14-16-30)22-8-4-3-7-21(22)24(33)28-18-9-11-27-12-10-18/h1-12H,13-17H2,(H,27,28,33) |
| InChIKey | YAMAAVTYUBNJQU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|