C20H23N5O4 — CID 87481327
2-[4-(2-formamidoacetyl)piperazin-1-yl]-N-(2-methoxy-4-pyridinyl)benzamide (PubChem CID 87481327) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-[4-(2-formamidoacetyl)piperazin-1-yl]-N-(2-methoxy-4-pyridinyl)benzamide.
| Compound Name | 2-[4-(2-formamidoacetyl)piperazin-1-yl]-N-(2-methoxy-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 87481327 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[4-(2-formamidoacetyl)piperazin-1-yl]-N-(2-methoxy-4-pyridinyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2N2CCN(C(=O)CNC=O)CC2)ccn1 |
| InChI | InChI=1S/C20H23N5O4/c1-29-18-12-15(6-7-22-18)23-20(28)16-4-2-3-5-17(16)24-8-10-25(11-9-24)19(27)13-21-14-26/h2-7,12,14H,8-11,13H2,1H3,(H,21,26)(H,22,23,28) |
| InChIKey | LUANPDVFZYOPGL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|