C21H22N6O — CID 59549144
N'-[2-[3-[(3-cyclopropyl-6-oxopyridazin-1-yl)methyl]phenyl]pyrimidin-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 59549144) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is N'-[2-[3-[(3-cyclopropyl-6-oxopyridazin-1-yl)methyl]phenyl]pyrimidin-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-[3-[(3-cyclopropyl-6-oxopyridazin-1-yl)methyl]phenyl]pyrimidin-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 59549144 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N'-[2-[3-[(3-cyclopropyl-6-oxopyridazin-1-yl)methyl]phenyl]pyrimidin-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1cnc(-c2cccc(Cn3nc(C4CC4)ccc3=O)c2)nc1 |
| InChI | InChI=1S/C21H22N6O/c1-26(2)14-24-18-11-22-21(23-12-18)17-5-3-4-15(10-17)13-27-20(28)9-8-19(25-27)16-6-7-16/h3-5,8-12,14,16H,6-7,13H2,1-2H3/b24-14+ |
| InChIKey | ALPOUIYCKGTBTR-ZVHZXABRSA-N |
| XLogP | 2.85 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|