C22H19N5O3S — CID 59484949
2-[[3-(5-aminopyrimidin-2-yl)phenyl]methyl]-6-(4-methylsulfonylphenyl)pyridazin-3-one (PubChem CID 59484949) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is 2-[[3-(5-aminopyrimidin-2-yl)phenyl]methyl]-6-(4-methylsulfonylphenyl)pyridazin-3-one.
| Compound Name | 2-[[3-(5-aminopyrimidin-2-yl)phenyl]methyl]-6-(4-methylsulfonylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 59484949 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[[3-(5-aminopyrimidin-2-yl)phenyl]methyl]-6-(4-methylsulfonylphenyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(=O)n(Cc3cccc(-c4ncc(N)cn4)c3)n2)cc1 |
| InChI | InChI=1S/C22H19N5O3S/c1-31(29,30)19-7-5-16(6-8-19)20-9-10-21(28)27(26-20)14-15-3-2-4-17(11-15)22-24-12-18(23)13-25-22/h2-13H,14,23H2,1H3 |
| InChIKey | UJQRIIKBCUGEMK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |