C30H23N5O4S — CID 171637177
[3-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]phenyl]methyl methanesulfonate (PubChem CID 171637177) has the molecular formula C30H23N5O4S and a molecular weight of 549.61 g/mol. Its IUPAC name is [3-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]phenyl]methyl methanesulfonate.
| Compound Name | [3-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 171637177 |
| Molecular Formula | C30H23N5O4S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | [3-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]phenyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cccc(-c2cnc(-c3cccc(Cn4nc(-c5cccc(C#N)c5)ccc4=O)c3)nc2)c1 |
| InChI | InChI=1S/C30H23N5O4S/c1-40(37,38)39-20-23-7-4-8-24(15-23)27-17-32-30(33-18-27)26-10-3-6-22(14-26)19-35-29(36)12-11-28(34-35)25-9-2-5-21(13-25)16-31/h2-15,17-18H,19-20H2,1H3 |
| InChIKey | FJVBXHUJFMPUPV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|