C26H23N7O — CID 59484871
3-[6-oxo-1-[[3-(5-piperazin-1-ylpyrimidin-2-yl)phenyl]methyl]pyridazin-3-yl]benzonitrile (PubChem CID 59484871) has the molecular formula C26H23N7O and a molecular weight of 449.52 g/mol. Its IUPAC name is 3-[6-oxo-1-[[3-(5-piperazin-1-ylpyrimidin-2-yl)phenyl]methyl]pyridazin-3-yl]benzonitrile.
| Compound Name | 3-[6-oxo-1-[[3-(5-piperazin-1-ylpyrimidin-2-yl)phenyl]methyl]pyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 59484871 |
| Molecular Formula | C26H23N7O |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-[6-oxo-1-[[3-(5-piperazin-1-ylpyrimidin-2-yl)phenyl]methyl]pyridazin-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(=O)n(Cc3cccc(-c4ncc(N5CCNCC5)cn4)c3)n2)c1 |
| InChI | InChI=1S/C26H23N7O/c27-15-19-3-1-5-21(13-19)24-7-8-25(34)33(31-24)18-20-4-2-6-22(14-20)26-29-16-23(17-30-26)32-11-9-28-10-12-32/h1-8,13-14,16-17,28H,9-12,18H2 |
| InChIKey | JZOQPJAGEQMHHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |