C29H29N7O4 — CID 75216629
2-amino-N-[2-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]oxyethyl]-3-methoxybutanamide (PubChem CID 75216629) has the molecular formula C29H29N7O4 and a molecular weight of 539.60 g/mol. Its IUPAC name is 2-amino-N-[2-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]oxyethyl]-3-methoxybutanamide.
| Compound Name | 2-amino-N-[2-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]oxyethyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 75216629 |
| Molecular Formula | C29H29N7O4 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 2-amino-N-[2-[2-[3-[[3-(3-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]pyrimidin-5-yl]oxyethyl]-3-methoxybutanamide |
| SMILES | COC(C)C(N)C(=O)NCCOc1cnc(-c2cccc(Cn3nc(-c4cccc(C#N)c4)ccc3=O)c2)nc1 |
| InChI | InChI=1S/C29H29N7O4/c1-19(39-2)27(31)29(38)32-11-12-40-24-16-33-28(34-17-24)23-8-4-6-21(14-23)18-36-26(37)10-9-25(35-36)22-7-3-5-20(13-22)15-30/h3-10,13-14,16-17,19,27H,11-12,18,31H2,1-2H3,(H,32,38) |
| InChIKey | DLDMBJFQXPKRSU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 158.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|