About 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde
3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde (PubChem CID 59550685) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde |
| PubChem CID | 59550685 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde |
| SMILES | CCn1c(=O)cc(C=O)[nH]c1=O |
| InChI | InChI=1S/C7H8N2O3/c1-2-9-6(11)3-5(4-10)8-7(9)12/h3-4H,2H2,1H3,(H,8,12) |
| InChIKey | IPUJHQHVWYLVHD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde?
The IUPAC name of 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde (CID 59550685) is 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde.
What is the SMILES notation for 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde?
The canonical SMILES for 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde is CCn1c(=O)cc(C=O)[nH]c1=O.
What is the InChIKey of 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde?
The InChIKey is IPUJHQHVWYLVHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-2-9-6(11)3-5(4-10)8-7(9)12/h3-4H,2H2,1H3,(H,8,12).
What are the key properties of 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde?
3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde has a molecular weight of 168.15 g/mol, XLogP of -0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dioxo-1H-pyrimidine-6-carbaldehyde is sourced from PubChem (CID 59550685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).