C27H41F2N5O5 — CID 59551268
(5R,8S)-7-[(2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]-N-(1-amino-5,5-difluoro-1,2-dioxopentan-3-yl)-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide (PubChem CID 59551268) has the molecular formula C27H41F2N5O5 and a molecular weight of 553.65 g/mol. Its IUPAC name is (5R,8S)-7-[(2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]-N-(1-amino-5,5-difluoro-1,2-dioxopentan-3-yl)-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide.
| Compound Name | (5R,8S)-7-[(2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]-N-(1-amino-5,5-difluoro-1,2-dioxopentan-3-yl)-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide |
|---|---|
| PubChem CID | 59551268 |
| Molecular Formula | C27H41F2N5O5 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | (5R,8S)-7-[(2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]-N-(1-amino-5,5-difluoro-1,2-dioxopentan-3-yl)-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C1(N)CC1)C(=O)N1C[C@]2(C[C@H]1C(=O)NC(CC(F)F)C(=O)C(N)=O)C(C)(C)C21CCC1 |
| InChI | InChI=1S/C27H41F2N5O5/c1-23(2,3)18(33-22(39)25(31)9-10-25)21(38)34-13-27(24(4,5)26(27)7-6-8-26)12-15(34)20(37)32-14(11-16(28)29)17(35)19(30)36/h14-16,18H,6-13,31H2,1-5H3,(H2,30,36)(H,32,37)(H,33,39)/t14?,15-,18+,27+/m0/s1 |
| InChIKey | AZUJAXGDGUHPMN-GJUCAQKUSA-N |
| XLogP | 1.00 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|