C32H23N3O6 — CID 59551643
4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-5-(1,3-dioxoisoindol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 59551643) has the molecular formula C32H23N3O6 and a molecular weight of 545.55 g/mol. Its IUPAC name is 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-5-(1,3-dioxoisoindol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-5-(1,3-dioxoisoindol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 59551643 |
| Molecular Formula | C32H23N3O6 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-5-(1,3-dioxoisoindol-2-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc(N2C(=O)C3C4C=CC(C4)C3C2=O)c1 |
| InChI | InChI=1S/C32H23N3O6/c36-27-21-3-1-2-4-22(21)28(37)33(27)18-11-19(34-29(38)23-14-5-6-15(9-14)24(23)30(34)39)13-20(12-18)35-31(40)25-16-7-8-17(10-16)26(25)32(35)41/h1-8,11-17,23-26H,9-10H2 |
| InChIKey | ICXTVYJQHZNHPV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|