About 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile
4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile (PubChem CID 59551979) has the molecular formula C25H21ClN2O2
and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile |
| PubChem CID | 59551979 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile |
| SMILES | N#Cc1ccc(O[C@@H](c2ccc(Cl)cc2)[C@@H](c2ccccc2)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C25H21ClN2O2/c26-21-12-10-20(11-13-21)25(30-22-14-8-18(17-27)9-15-22)24(19-5-2-1-3-6-19)28-16-4-7-23(28)29/h1-3,5-6,8-15,24-25H,4,7,16H2/t24-,25+/m1/s1 |
| InChIKey | YWUSJFYQJBRJNW-RPBOFIJWSA-N |
| XLogP | 5.70 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile?
The IUPAC name of 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile (CID 59551979) is 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile.
What is the SMILES notation for 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile?
The canonical SMILES for 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile is N#Cc1ccc(O[C@@H](c2ccc(Cl)cc2)[C@@H](c2ccccc2)N2CCCC2=O)cc1.
What is the InChIKey of 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile?
The InChIKey is YWUSJFYQJBRJNW-RPBOFIJWSA-N. The full InChI is InChI=1S/C25H21ClN2O2/c26-21-12-10-20(11-13-21)25(30-22-14-8-18(17-27)9-15-22)24(19-5-2-1-3-6-19)28-16-4-7-23(28)29/h1-3,5-6,8-15,24-25H,4,7,16H2/t24-,25+/m1/s1.
What are the key properties of 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile?
4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile has a molecular weight of 416.91 g/mol, XLogP of 5.70, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2R)-1-(4-chlorophenyl)-2-(2-oxopyrrolidin-1-yl)-2-phenylethoxy]benzonitrile is sourced from PubChem (CID 59551979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).