C13H12N2O4 — CID 59552253
1-nitro-3-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]benzene (PubChem CID 59552253) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-nitro-3-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]benzene.
| Compound Name | 1-nitro-3-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]benzene |
|---|---|
| PubChem CID | 59552253 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-nitro-3-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]benzene |
| SMILES | O=[N+]([O-])C1=CC(Cc2cccc([N+](=O)[O-])c2)CC=C1 |
| InChI | InChI=1S/C13H12N2O4/c16-14(17)12-5-1-3-10(8-12)7-11-4-2-6-13(9-11)15(18)19/h1-3,5-6,8-9,11H,4,7H2 |
| InChIKey | FTTGUZYMLQMJGC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|