About 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine
4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine (PubChem CID 59556428) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine.
Molecular Properties
| Compound Name | 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine |
| PubChem CID | 59556428 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine |
| SMILES | Cc1noc(C2CN(C)CCO2)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-6-9-8(13-10-6)7-5-11(2)3-4-12-7/h7H,3-5H2,1-2H3 |
| InChIKey | NKAKVQJFYXVHNX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine?
The IUPAC name of 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine (CID 59556428) is 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine.
What is the SMILES notation for 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine?
The canonical SMILES for 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine is Cc1noc(C2CN(C)CCO2)n1.
What is the InChIKey of 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine?
The InChIKey is NKAKVQJFYXVHNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-6-9-8(13-10-6)7-5-11(2)3-4-12-7/h7H,3-5H2,1-2H3.
What are the key properties of 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine?
4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine has a molecular weight of 183.21 g/mol, XLogP of 0.38, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)morpholine is sourced from PubChem (CID 59556428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).