C9H15N5O — CID 79085098
4-methyl-6-(4-methylmorpholin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 79085098) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-methyl-6-(4-methylmorpholin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-methyl-6-(4-methylmorpholin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79085098 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-methyl-6-(4-methylmorpholin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(N)nc(C2CN(C)CCO2)n1 |
| InChI | InChI=1S/C9H15N5O/c1-6-11-8(13-9(10)12-6)7-5-14(2)3-4-15-7/h7H,3-5H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | VSSNCNBXJLGLEQ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |