About carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+)
carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) (PubChem CID 59559427) has the molecular formula C11H11NO2Yb
and a molecular weight of 362.25 g/mol. Its IUPAC name is carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+).
Molecular Properties
| Compound Name | carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) |
| PubChem CID | 59559427 |
| Molecular Formula | C11H11NO2Yb |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) |
| SMILES | O=C(O)Cn1c[c-]c2ccccc21.[CH3-].[Yb+2] |
| InChI | InChI=1S/C10H8NO2.CH3.Yb/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11;;/h1-4,6H,7H2,(H,12,13);1H3;/q2*-1;+2 |
| InChIKey | HQCQWVCLJQOYMD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+)?
The IUPAC name of carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) (CID 59559427) is carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+).
What is the SMILES notation for carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+)?
The canonical SMILES for carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) is O=C(O)Cn1c[c-]c2ccccc21.[CH3-].[Yb+2].
What is the InChIKey of carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+)?
The InChIKey is HQCQWVCLJQOYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8NO2.CH3.Yb/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11;;/h1-4,6H,7H2,(H,12,13);1H3;/q2*-1;+2.
What are the key properties of carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+)?
carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) has a molecular weight of 362.25 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-(3H-indol-3-id-1-yl)acetic acid;ytterbium(2+) is sourced from PubChem (CID 59559427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).