C8H8N2O6 — CID 95916407
2-[4-(carboxymethyl)-2,3-dioxopyrazin-1-yl]acetic acid (PubChem CID 95916407) has the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-2,3-dioxopyrazin-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-2,3-dioxopyrazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 95916407 |
| Molecular Formula | C8H8N2O6 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-[4-(carboxymethyl)-2,3-dioxopyrazin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccn(CC(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C8H8N2O6/c11-5(12)3-9-1-2-10(4-6(13)14)8(16)7(9)15/h1-2H,3-4H2,(H,11,12)(H,13,14) |
| InChIKey | IXBHTJCESYXCNM-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|