C16H20N4O8 — CID 141341834
2-[(2Z,5Z,8Z,11Z)-4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododeca-2,5,8,11-tetraen-1-yl]acetic acid (PubChem CID 141341834) has the molecular formula C16H20N4O8 and a molecular weight of 396.36 g/mol. Its IUPAC name is 2-[(2Z,5Z,8Z,11Z)-4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododeca-2,5,8,11-tetraen-1-yl]acetic acid.
| Compound Name | 2-[(2Z,5Z,8Z,11Z)-4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododeca-2,5,8,11-tetraen-1-yl]acetic acid |
|---|---|
| PubChem CID | 141341834 |
| Molecular Formula | C16H20N4O8 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[(2Z,5Z,8Z,11Z)-4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododeca-2,5,8,11-tetraen-1-yl]acetic acid |
| SMILES | O=C(O)CN1/C=C\N(CC(=O)O)/C=C\N(CC(=O)O)/C=C\N(CC(=O)O)/C=C\1 |
| InChI | InChI=1S/C16H20N4O8/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h1-8H,9-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28)/b2-1-,4-3-,6-5-,8-7- |
| InChIKey | HPEWOTROHLWAJI-JCJVRDIZSA-N |
| XLogP | -0.57 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |