C17H26N4O7 — CID 134129082
2-[(5E,8Z,11Z)-4,7-bis(carboxymethyl)-10-[(2R)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododeca-5,8,11-trien-1-yl]acetic acid (PubChem CID 134129082) has the molecular formula C17H26N4O7 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(5E,8Z,11Z)-4,7-bis(carboxymethyl)-10-[(2R)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododeca-5,8,11-trien-1-yl]acetic acid.
| Compound Name | 2-[(5E,8Z,11Z)-4,7-bis(carboxymethyl)-10-[(2R)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododeca-5,8,11-trien-1-yl]acetic acid |
|---|---|
| PubChem CID | 134129082 |
| Molecular Formula | C17H26N4O7 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[(5E,8Z,11Z)-4,7-bis(carboxymethyl)-10-[(2R)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododeca-5,8,11-trien-1-yl]acetic acid |
| SMILES | C[C@@H](O)CN1/C=C\N(CC(=O)O)/C=C/N(CC(=O)O)CCN(CC(=O)O)/C=C\1 |
| InChI | InChI=1S/C17H26N4O7/c1-14(22)10-18-2-4-19(11-15(23)24)6-8-21(13-17(27)28)9-7-20(5-3-18)12-16(25)26/h2-6,8,14,22H,7,9-13H2,1H3,(H,23,24)(H,25,26)(H,27,28)/b4-2-,5-3-,8-6+/t14-/m1/s1 |
| InChIKey | AZGVTEFHQMIZEN-KEOVPILASA-N |
| XLogP | -0.74 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |